Name | R(+)-1-phenyl-1-propanol |
Synonyms | (R)-1-PHENYL-PROPANOL (R)-1-PHENYLPROPAN-1-OL R(+)-1-phenyl-1-propanol (R)-(+)-1-PHENYL-1-PROPANOL (R)-ALPHA-ETHYLBENZYL ALCOHOL (R)-(+)-1-Phenyl-1-propanol ee, (R)-(+)-ALPHA-ETHYLBENZYL ALCOHOL |
CAS | 1565-74-8 |
InChI | InChI=1/C9H12O/c1-2-9(10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3/t9-/m1/s1 |
Molecular Formula | C9H12O |
Molar Mass | 136.19 |
Density | 0.993g/mLat 20°C(lit.) |
Boling Point | 218-220°C(lit.) |
Flash Point | 194°F |
Solubility | 10.33g/l |
Vapor Presure | 0.0707mmHg at 25°C |
Specific Gravity | 0.993 |
BRN | 2041555 |
pKa | 14.43±0.20(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | n20/D 1.5196(lit.) |
Use | Use of chiral structural units. |
Hazard Symbols | Xn - Harmful |
Risk Codes | 22 - Harmful if swallowed |
Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
UN IDs | UN 2810 6.1/PG 3 |
WGK Germany | 3 |
RTECS | DO5470000 |
HS Code | 29052900 |
Raw Materials | (R)-(-)-ALPHA-(TRIFLUOROMETHYL)BENZYL ALCOHOL (S)-(+)-ALPHA-(TRIFLUOROMETHYL)BENZYL ALCOHOL Trifluoroacetophenone Benzaldehyde Diethylzinc |
boiling point | 218-220 °C(lit.) |
density | 0.993 g/mL at 20 °C(lit.) |
refractive index | n20/D 1.5196(lit.) |
flash point | 194 °F |
storage conditions | Sealed in dry,Room Temperature |
solubility | 10.33g/l |
acidity coefficient (pKa) | 14.43±0.20(Predicted) |
Specific gravity | 0.993 |
optical activity (optical activity) | [α]20/D 48°, c = 2.25 in hexane |
BRN | 2041555 |
dangerous goods mark | Xn |
hazard category code | 22 |
safety instructions | 23-24/25 |
dangerous goods transport number | UN 2810 6.1/PG 3 |
WGK Germany | 3 |
RTECS number | DO5470000 |
customs code | 29052900 |
use | chiral structural unit. |